/** * @class Ext.view.AbstractView * This is an abstract superclass and should not be used directly. Please see {@link Ext.view.View}. * @private */Ext.define('Ext.view.AbstractView', { extend: 'Ext.Component', requires: [ 'Ext.LoadMask', 'Ext.CompositeElementLite', 'Ext.selection.DataViewModel', 'Ext.view.NavigationModel', 'Ext.util.CSS' ], mixins: [ 'Ext.util.StoreHolder' ], isDataView: true, inheritableStatics: { /** * @private * @static * @inheritable */ getRecord: function(node) { return this.getBoundView(node).getRecord(node); }, /** * @private * @static * @inheritable */ getBoundView: function(node) { return Ext.getCmp(node.getAttribute('data-boundView')); } }, /** * @property defaultBindProperty * @inheritdoc */ defaultBindProperty: 'store', /** * @private * Used for buffered rendering. */ renderBuffer: new Ext.dom.Fly(document.createElement('div')), statics: { /** * @prop {Number} [updateDelay=200] Global config for use when using {@link #throttledUpdate throttled view updating} if the data in the backing {@link Ext.data.Store store} * is being changed rapidly, for example receiving changes from the server through a WebSocket connection. * * To avoid too-frequent view updates overloading the browser with style recalculation, layout and paint requests, updates can be {@link #throttledUpdate throttled} to * coalesced, and applied at the interval specified in milliseconds. * * Note that on lower powered devices, updating is throttled to once every second. */ updateDelay: Ext.platformTags.desktop ? 200: 1000, queueRecordChange: function(view, store, record, operation, modifiedFieldNames) { var me = this, changeQueue = me.changeQueue || (me.changeQueue = {}), recId = record.internalId, recChange, updated, len, i, fieldName, value, checkForReversion; recChange = changeQueue[recId] || (changeQueue[recId] = { operation: operation, record: record, data: {}, views: [] }); // Hash of original values updated = recChange.data; // Make sure this view is among those updated when record changes are flushed Ext.Array.include(recChange.views, view); // Note the following condition tests the result of an assignment statement. // If we have been informed that specific fields have changed. if (modifiedFieldNames && (len = modifiedFieldNames.length)) { for (i = 0; i < len; i++) { fieldName = modifiedFieldNames[i]; value = record.data[fieldName]; // More than one update is being performed... if (updated.hasOwnProperty(fieldName)) { // If the update is back to the original value, this may have reverted the record to original state if (record.isEqual(updated[fieldName], value)) { delete updated[fieldName]; checkForReversion = true; } } // On first update, cache the original value else { updated[fieldName] = value; } } // If the record has been returned to its original state, delete the queue entry. // checkForReversion flag saves the expensive (on legacy browsers) call to Ext.Object.getKeys if (checkForReversion && !Ext.Object.getKeys(updated).length) { delete changeQueue[recId]; } } // Unspecified fields have changed. We have to collect the whole data object. else { Ext.apply(updated, record.data); } // Create a task which will call flushChangeQueue in updateDelay milliseconds from the time it's invoked. if (!me.flushQueueTask) { me.flushQueueTask = new Ext.util.DelayedTask(Ext.global.requestAnimationFrame ? Ext.Function.createAnimationFrame(me.flushChangeQueue, me) : me.flushChangeQueue.bind(me), me, null, false); } if (!me.flushTimer) { me.flushTimer = me.flushQueueTask.delay(Ext.view.AbstractView.updateDelay); } }, /** * @private * Flushes all queued field updates to the UI. * * Called in the context of the AbstractView class. * * The queue is shared across all Views so that there is only one global flush operation. */ flushChangeQueue: function() { // Maintainer: Note that "me" references AbstractView class var me = this, dirtyViews, len, changeQueue, recChange, recId, i, view; // If there is scrolling going on anywhere, requeue the flush operation ASAP. if (Ext.isScrolling) { return me.flushTimer = me.flushQueueTask.delay(1); } me.flushTimer = null; changeQueue = me.changeQueue; // Empty the view's changeQueue me.changeQueue = {}; for (recId in changeQueue) { recChange = changeQueue[recId]; dirtyViews = recChange.views; len = dirtyViews.length; // Loop through all the views which have outstanding changes. for (i = 0; i < len; i++) { view = dirtyViews[i]; // View may have been destroyed during the buffered phase. if (!view.destroyed) { view.handleUpdate(view.dataSource, recChange.record, recChange.operation, Ext.Object.getKeys(recChange.data)); } } } } }, config: { /** * @cfg {Ext.data.Store} store * The {@link Ext.data.Store} to bind this DataView to. * @since 2.3.0 */ store: 'ext-empty-store', // @cmd-auto-dependency { aliasPrefix: 'view.navigation.' } /** * @private * The {@link Ext.view.NavigationModel} [default] alias to use. * @since 5.0.1 */ navigationModel: { type: 'default' }, // @cmd-auto-dependency { aliasPrefix: 'selection.' } /** * @cfg {Object/Ext.selection.DataViewModel} selectionModel * The {@link Ext.selection.Model selection model} [dataviewmodel] config or alias to use. * @since 5.1.0 */ selectionModel: { type: 'dataviewmodel' } }, /** * @cfg publishes * @inheritdoc */ publishes: ['selection'], /** * @cfg twoWayBindable * @inheritdoc */ twoWayBindable: ['selection'], /** * @cfg {Ext.data.Model} selection * The selected model. Typically used with {@link #bind binding}. */ selection: null, /** * @cfg {Boolean} throttledUpdate * Configure as `true` to have this view participate in the global throttled update queue which flushes store changes to the UI at a maximum rate * determined by the {@link #updateDelay} setting. */ throttledUpdate: false, /** * @cfg {String/String[]/Ext.XTemplate} tpl (required) * The HTML fragment or an array of fragments that will make up the template used by this DataView. This should * be specified in the same format expected by the constructor of {@link Ext.XTemplate}. When a `tpl` is specified, * this class assumes that records are rendered in the order they appear in the `{@link #store}`. If a custom `tpl` * does not conform to this assumption, index values will be incorrect which may cause the view to misbehave. * @since 2.3.0 */ /** * @cfg {Boolean} deferInitialRefresh * Configure as 'true` to defer the initial refresh of the view. * * This allows the View to execute its render and initial layout more quickly because the process will not be encumbered * by the update of the view structure. */ deferInitialRefresh: false, /** * @cfg {String} itemSelector (required) * <b>This is a required setting</b>. A simple CSS selector (e.g. `div.some-class` or * `span:first-child`) that will be used to determine what nodes this DataView will be * working with. The itemSelector is used to map DOM nodes to records. As such, there should * only be one root level element that matches the selector for each record. The itemSelector * will be automatically configured if the {@link #itemTpl} config is used. * * new Ext.view.View({ * renderTo: Ext.getBody(), * store: { * fields: ['name'], * data: [ * {name: 'Item 1'}, * {name: 'Item 2'} * ] * }, * tpl: [ * '<ul>', * '<tpl for=".">', * '<li>{name}</li>', * '</tpl>', * '</ul>' * ], * // Match the li, since each one maps to a record * itemSelector: 'li' * }); * * @since 2.3.0 */ /** * @cfg {String} itemCls * Specifies the class to be assigned to each element in the view when used in conjunction with the * {@link #itemTpl} configuration. * @since 2.3.0 */ itemCls: Ext.baseCSSPrefix + 'dataview-item', /** * @cfg {String/String[]/Ext.XTemplate} itemTpl * The inner portion of the item template to be rendered. Follows an XTemplate * structure and will be placed inside of a tpl. */ /** * @cfg {String} overItemCls * A CSS class to apply to each item in the view on mouseover. * Setting this will automatically set {@link #trackOver} to `true`. */ /** * @cfg {String} loadingText * A string to display during data load operations. If specified, this text will be * displayed in a loading div and the view's contents will be cleared while loading, otherwise the view's * contents will continue to display normally until the new data is loaded and the contents are replaced. * @since 2.3.0 * @locale */ loadingText: 'Loading...', /** * @cfg {Boolean/Object} loadMask * False to disable a load mask from displaying while the view is loading. This can also be a * {@link Ext.LoadMask} configuration object. */ loadMask: true, /** * @cfg {String} loadingCls * The CSS class to apply to the loading message element. Defaults to Ext.LoadMask.prototype.msgCls "x-mask-loading". */ /** * @cfg {Boolean} loadingUseMsg * Whether or not to use the loading message. * @private */ loadingUseMsg: true, /** * @cfg {Number} loadingHeight * If specified, gives an explicit height for the data view when it is showing the {@link #loadingText}, * if that is specified. This is useful to prevent the view's height from collapsing to zero when the * loading mask is applied and there are no other contents in the data view. */ /** * @cfg {String} selectedItemCls * A CSS class to apply to each selected item in the view. */ selectedItemCls: Ext.baseCSSPrefix + 'item-selected', /** * @cfg {String} emptyText * The text to display in the view when there is no data to display. * Note that when using local data the emptyText will not be displayed unless you set * the {@link #deferEmptyText} option to false. * @since 2.3.0 * @accessor * @locale */ emptyText: "", /** * @cfg {Boolean} deferEmptyText * True to defer emptyText being applied until the store's first load. * @since 2.3.0 */ deferEmptyText: true, /** * @cfg {Boolean} trackOver * When `true` the {@link #overItemCls} will be applied to items when hovered over. * This in return will also cause {@link Ext.view.View#highlightitem highlightitem} and * {@link Ext.view.View#unhighlightitem unhighlightitem} events to be fired. * * Enabled automatically when the {@link #overItemCls} config is set. * * @since 2.3.0 */ trackOver: false, /** * @cfg {Boolean} blockRefresh * Set this to true to ignore refresh events on the bound store. This is useful if * you wish to provide custom transition animations via a plugin * @since 3.4.0 */ blockRefresh: false, /** * @cfg {Boolean} [disableSelection=false] * True to disable selection within the DataView. This configuration will lock the selection model * that the DataView uses. */ /** * @cfg {Boolean} preserveScrollOnRefresh * True to preserve scroll position across refresh operations. */ preserveScrollOnRefresh: false, /** * @cfg {Boolean} preserveScrollOnReload * True to preserve scroll position when the store is reloaded. * * You may want to configure this as `true` if you are using a {@link Ext.data.BufferedStore buffered store} * and you require refreshes of the client side data state not to disturb the state of the UI. * * @since 5.1.1 */ preserveScrollOnReload: false, /** * @property autoDestroyBoundStore * @inheritdoc */ autoDestroyBoundStore: true, /** * @property ariaRole * @inheritdoc */ ariaRole: 'listbox', itemAriaRole: 'option', /** * @private */ last: false, /** * @property focusable * @inheritdoc */ focusable: true, /** * @cfg tabIndex * @inheritdoc */ tabIndex: 0, triggerEvent: 'itemclick', triggerCtEvent: 'containerclick', // Starts as true by default so that pn the leading edge of the first layout a refresh will be triggered. // A refresh opereration sets this flag to false. // When a refresh is requested using refreshView, the request may be deferred because of hidden or collapsed state. // This is done by setting the refreshNeeded flag to true, and the the next layout will trigger refresh. refreshNeeded: true, updateSuspendCounter: 0, addCmpEvents: Ext.emptyFn, /** * @event beforerefresh * Fires before the view is refreshed * @param {Ext.view.View} this The DataView object */ /** * @event refresh * Fires when the view is refreshed * @param {Ext.view.View} this The DataView object */ /** * @event viewready * Fires when the View's item elements representing Store items has been rendered. No items will be available * for selection until this event fires. * @param {Ext.view.View} this */ /** * @event itemupdate * Fires when the node associated with an individual record is updated * @param {Ext.data.Model} record The model instance * @param {Number} index The index of the record * @param {HTMLElement} node The node that has just been updated * @param {Ext.view.View} view The view containing the item */ /** * @event itemadd * Fires when the nodes associated with an recordset have been added to the underlying store * @param {Ext.data.Model[]} records The model instance * @param {Number} index The index at which the set of records was inserted * @param {HTMLElement[]} node The node that has just been updated * @param {Ext.view.View} view The view adding the item */ /** * @event itemremove * Fires when the node associated with an individual record is removed * @param {Ext.data.Model[]} records The model instances removed * @param {Number} index The index from which the records wer removed * @param {HTMLElement[]} item The view items removed * @param {Ext.view.View} view The view removing the item */ constructor: function(config) { if (config && config.selModel) { config.selectionModel = config.selModel; } this.callParent([config]); }, initComponent: function(){ var me = this, isDef = Ext.isDefined, itemTpl = me.itemTpl, memberFn = {}, selection = me.selection, store; if (selection) { me.selection = null; me.setSelection(selection); } if (itemTpl) { if (Ext.isArray(itemTpl)) { // string array if (typeof itemTpl[itemTpl.length - 1] !== 'string') { itemTpl = itemTpl.slice(0); memberFn = itemTpl.pop(); } itemTpl = itemTpl.join(''); } else if (Ext.isObject(itemTpl)) { // tpl instance memberFn = Ext.apply(memberFn, itemTpl.initialConfig); itemTpl = itemTpl.html; } if (!me.itemSelector) { me.itemSelector = '.' + me.itemCls; } if (memberFn.fn) { memberFn.baseFn = memberFn.fn; delete memberFn.fn; itemTpl = "{%this.baseFn(out, values, parent, xindex, xcount, xkey)%}"; } itemTpl = Ext.String.format('<tpl for="."><div class="{0}" role="{2}">{1}</div></tpl>', me.itemCls, itemTpl, me.itemAriaRole); me.tpl = new Ext.XTemplate(itemTpl, memberFn); } //<debug> if (!isDef(me.tpl) || !isDef(me.itemSelector)) { Ext.raise({ sourceClass: 'Ext.view.View', tpl: me.tpl, itemSelector: me.itemSelector, msg: "DataView requires both tpl and itemSelector configurations to be defined." }); } //</debug> me.callParent(); me.tpl = me.lookupTpl('tpl'); //<debug> // backwards compat alias for overClass/selectedClass // TODO: Consider support for overCls generation Ext.Component config if (isDef(me.overCls) || isDef(me.overClass)) { if (Ext.isDefined(Ext.global.console)) { Ext.global.console.warn('Ext.view.View: Using the deprecated overCls or overClass configuration. Use overItemCls instead.'); } me.overItemCls = me.overCls || me.overClass; delete me.overCls; delete me.overClass; } if (isDef(me.selectedCls) || isDef(me.selectedClass)) { if (Ext.isDefined(Ext.global.console)) { Ext.global.console.warn('Ext.view.View: Using the deprecated selectedCls or selectedClass configuration. Use selectedItemCls instead.'); } me.selectedItemCls = me.selectedCls || me.selectedClass; delete me.selectedCls; delete me.selectedClass; } //</debug> if (me.overItemCls) { me.trackOver = true; } me.addCmpEvents(); // Look up the configured Store. If none configured, use the fieldless, empty Store defined in Ext.data.Store. store = me.store = Ext.data.StoreManager.lookup(me.store || 'ext-empty-store'); // Use the provided store as the data source unless a Feature or plugin has injected a special one if (!me.dataSource) { me.dataSource = store; } me.bindStore(store, true); // Must exist before the selection model. // Selection model listens to this for navigation events. me.getNavigationModel().bindComponent(this); if (!me.all) { me.all = new Ext.CompositeElementLite(); } // We track the scroll position me.scrollState = { top: 0, left: 0 }; me.savedTabIndexAttribute = 'data-savedtabindex-' + me.id; }, getElConfig: function() { var result = this.mixins.renderable.getElConfig.call(this); // Subclasses may set focusable to false (BoundList is not focusable) if (this.focusable) { result.tabIndex = 0; } return result; }, onRender: function(parentNode , containerIdx) { var mask = this.loadMask; this.callParent([parentNode , containerIdx]); if (mask) { this.createMask(mask); } }, beforeLayout: function() { var me = this; me.callParent(); // If there is a deferred refresh timer running, allow that to do the refresh. if (me.refreshNeeded && !me.pendingRefresh) { // If we have refreshed before, just call a refresh now. if (me.refreshCounter) { me.refreshView(); } else { me.doFirstRefresh(me.dataSource); } } }, onMaskBeforeShow: function(){ var me = this, loadingHeight = me.loadingHeight; if (loadingHeight && loadingHeight > me.getHeight()) { me.hasLoadingHeight = true; me.oldMinHeight = me.minHeight; me.minHeight = loadingHeight; me.updateLayout(); } }, onMaskHide: function(){ var me = this; if (!me.destroying && me.hasLoadingHeight) { me.minHeight = me.oldMinHeight; me.updateLayout(); delete me.hasLoadingHeight; } }, beforeRender: function() { this.callParent(); this.getSelectionModel().beforeViewRender(this); }, afterRender: function() { this.callParent(); // Subclasses may set focusable to false. // BoundList is not focusable. // BoundList processes key events from its boundField. if (this.focusable) { this.focusEl = this.el; } }, getRefItems: function() { var mask = this.loadMask, result = []; if (mask && mask.isComponent) { result.push(mask); } return result; }, getSelection: function() { return this.getSelectionModel().getSelection(); }, /** * Sets the value of the selection. * @param {Ext.data.Model} selection */ setSelection: function(selection) { // This is purposefully written not as a config. Because getSelection // is an existing API that doesn't mirror the value for setSelection, we // don't want the publish system to call the getter, but rather just the // raw property. var current = this.selection; if (selection !== current) { this.selection = selection; this.updateSelection(selection, current); } }, updateSelection: function(selection) { var me = this, sm; if (!me.ignoreNextSelection) { me.ignoreNextSelection = true; sm = me.getSelectionModel(); if (selection) { sm.select(selection); } else { sm.deselectAll(); } me.ignoreNextSelection = false; } me.publishState('selection', selection); }, updateBindSelection: function(selModel, selection) { var me = this, selected = null; if (!me.ignoreNextSelection) { me.ignoreNextSelection = true; if (selection.length) { selected = selModel.getLastSelected(); me.hasHadSelection = true; } if (me.hasHadSelection) { me.setSelection(selected); } me.ignoreNextSelection = false; } }, applySelectionModel: function(selModel, oldSelModel) { var me = this, grid = me.grid, mode, ariaAttr, ariaDom; if (oldSelModel) { // Could be already destroyed, and listeners cleared if (!oldSelModel.destroyed) { oldSelModel.un({ scope: me, selectionchange: me.updateBindSelection, lastselectedchanged: me.updateBindSelection }); } Ext.destroy(me.selModelRelayer); selModel = Ext.Factory.selection(selModel); } // If this is the initial configuration, pull overriding configs in from this view else { if (selModel && selModel.isSelectionModel) { selModel.locked = me.disableSelection; } else { if (me.simpleSelect) { mode = 'SIMPLE'; } else if (me.multiSelect) { mode = 'MULTI'; } else { mode = 'SINGLE'; } if (typeof selModel === 'string') { selModel = { type: selModel }; } selModel = Ext.Factory.selection(Ext.apply({ allowDeselect: me.allowDeselect || me.multiSelect, mode: mode, locked: me.disableSelection }, selModel)); } } // Grids should have aria-multiselectable on their ariaEl instead if (selModel.mode !== 'SINGLE') { ariaDom = (grid || me).ariaEl.dom; if (ariaDom) { ariaDom.setAttribute('aria-multiselectable', true); } else if (!grid) { ariaAttr = me.ariaRenderAttributes || (me.ariaRenderAttributes = {}); ariaAttr['aria-multiselectable'] = true; } } me.selModelRelayer = me.relayEvents(selModel, [ 'selectionchange', 'beforeselect', 'beforedeselect', 'select', 'deselect', 'focuschange' ]); selModel.on({ scope: me, lastselectedchanged: me.updateBindSelection, selectionchange: me.updateBindSelection }); return selModel; }, updateSelectionModel: function(selectionModel) { // Keep the legacy property correct this.selModel = selectionModel; }, applyNavigationModel: function (navigationModel) { return Ext.Factory.viewNavigation(navigationModel); }, onFocusEnter: function(e) { var me = this, navigationModel = me.getNavigationModel(), focusPosition = me.lastFocused; // This is set on mousedown on the scrollbar in IE/Edge. // Those browsers focus the element on mousedown on its scrollbar // which is not what we want, so throw focus back in this // situation. // See Ext.view.navigationModel for this being set. me.lastFocused = null; if (focusPosition === 'scrollbar') { e.relatedTarget.focus(); return; } // Disable tabbability of elements within this view. me.toggleChildrenTabbability(false); if (!me.itemFocused && me.all.getCount()) { // SHIFT+TAB hit the tab guard - focus last item. if (e.event.getTarget() === me.tabGuardEl) { focusPosition = me.all.getCount() - 1; } else { focusPosition = navigationModel.getLastFocused(); } navigationModel.setPosition(focusPosition || 0, e.event, null, !focusPosition); // We now contain focus is that was successful me.itemFocused = navigationModel.getPosition() != null; } // View's main el should be kept untabbable, otherwise pressing // Shift-Tab key in the view would move the focus to the main el // which will then bounce it back to the last focused item. // That would effectively make Shift-Tab unusable. if (me.itemFocused) { me.el.dom.setAttribute('tabIndex', -1); if (me.tabGuardEl) { me.tabGuardEl.setAttribute('tabIndex', -1); } } me.callParent([e]); }, onFocusLeave: function(e) { var me = this; // Ignore this event if we do not actually contain focus, // or if the reason for focus exiting was that we are refreshing. if (me.itemFocused && !me.refreshing) { // Blur the focused cell me.getNavigationModel().setPosition(null, e.event, null, true); me.itemFocused = false; me.el.dom.setAttribute('tabIndex', 0); if (me.tabGuardEl) { me.tabGuardEl.setAttribute('tabIndex', 0); } } me.callParent([e]); }, /** * @private * Cancel a pending focus task, if any. * This is a separate method to allow simple abstraction for locked views. */ cancelFocusTask: function() { var task = this.getFocusTask(); if (task) { task.cancel(); } }, onRemoved: function(isDestroying) { this.callParent([isDestroying]); // IE does not fire focusleave on removal from DOM if (!isDestroying) { this.onFocusLeave({}); } }, /** * Refreshes the view by reloading the data from the store and re-rendering the template. * * @since 2.3.0 */ refresh: function() { var me = this, items = me.all, prevItemCount = items.getCount(), refreshCounter = me.refreshCounter, targetEl, records, selModel = me.getSelectionModel(), restoreFocus, // If there are items in the view, then honour preserveScrollOnRefresh scroller = refreshCounter && items.getCount() && me.preserveScrollOnRefresh && me.getScrollable(), bufferedRenderer = me.bufferedRenderer, scrollPos; if (!me.rendered || me.destroyed) { return; } if (!me.hasListeners.beforerefresh || me.fireEvent('beforerefresh', me) !== false) { // So that listeners to itemremove events know that its because of a refresh me.refreshing = true; // If focus was in this view, this will restore it restoreFocus = me.saveFocusState(); targetEl = me.getTargetEl(); records = me.getViewRange(); if (scroller) { scrollPos = scroller.getPosition(); if (!(scrollPos.x || scrollPos.y)) { scrollPos = null; } } if (refreshCounter || me.emptyEl) { me.clearViewEl(); } if (refreshCounter) { me.refreshCounter++; } else { me.refreshCounter = 1; } // Usually, for an empty record set, this would be blank, but when the Template // Creates markup outside of the record loop, this must still be honoured even if there are no // records. me.tpl.append(targetEl, me.collectData(records, items.startIndex || 0)); // The emptyText is now appended to the View's element // after nodes outside the tpl block. if (records.length < 1) { // Process empty text unless the store is being cleared. me.addEmptyText(); items.clear(); } else { me.collectNodes(targetEl.dom); me.updateIndexes(0); } // If focus was in any way in this view, this will restore it restoreFocus(); // Some subclasses do not need to do this. TableView does not need to do this - it renders selected class using its tenmplate. if (me.refreshSelmodelOnRefresh !== false) { selModel.refresh(); } me.refreshNeeded = false; // Ensure layout system knows about new content size. // If number of items have changed, force a layout. me.refreshSize(items.getCount() !== prevItemCount); me.fireItemMutationEvent('refresh', me, records); if (scroller) { scroller.scrollTo(scrollPos); } // Upon first refresh, fire the viewready event. // Reconfiguring the grid "renews" this event. if (!me.viewReady) { // Fire an event when deferred content becomes available. me.viewReady = true; me.fireEvent('viewready', me); } me.refreshing = false; if (bufferedRenderer) { bufferedRenderer.refreshSize(); } me.cleanupData(); } // The tabGuardEl is only needed before focus has entered the view to prevent // naturally tabbable interior elements from attracting focus when using SHIFT+TAB // from after the view. Once focus has entered, we disable tabbability on interior // elements so it will not be needed. // Subsequent *full* refreshes will destroy it. // Buffer rendered refreshes are more granular, and do not destroy extraneous // DOM, but this does not matter because tha tabGuardEl will be tabIndex="-1" // so out of the tab order. if (!me.tabGuardEl) { // We only need an "after" tab guard. // The View el is tabIndex="0", so captures forward TAB. // It's only SHIFT+TAB that we have to guard against. me.tabGuardEl = me.el.createChild({ cls: Ext.baseCSSPrefix + 'tab-guard ' + Ext.baseCSSPrefix + 'tab-guard-after', tabIndex: "0" }, null, true); } }, addEmptyText: function() { var me = this, store = me.getStore(); if (me.emptyText && !store.isLoading() && (!me.deferEmptyText || me.refreshCounter > 1 || store.isLoaded())) { if (!me.emptyEl) { me.emptyEl = Ext.core.DomHelper.insertHtml('beforeEnd', me.getTargetEl().dom, me.emptyText); } else { Ext.fly(me.emptyEl).setHtml(me.emptyText); } } }, getEmptyText: function () { return this.emptyText; }, setEmptyText: function (emptyText) { var me = this; if (me.emptyText !== emptyText) { me.emptyText = emptyText; me.refresh(); } return me; }, getViewRange: function() { return this.dataSource.getRange(); }, /** * @private * Called by the framework when the view is refreshed, or when rows are added or deleted. * * These operations may cause the view's dimensions to change, and if the owning container * is shrinkwrapping this view, then the layout must be updated to accommodate these new dimensions. */ refreshSize: function(forceLayout) { var me = this, sizeModel = me.getSizeModel(); if (sizeModel.height.shrinkWrap || sizeModel.width.shrinkWrap || forceLayout) { me.updateLayout(); } }, afterFirstLayout: function(width, height) { var me = this, scroller = me.getScrollable(); if (scroller) { me.viewScrollListeners = scroller.on({ scroll: me.onViewScroll, scrollend: me.onViewScrollEnd, scope: me, onFrame: !!Ext.global.requestAnimationFrame, destroyable: true }); } me.callParent([width, height]); }, clearViewEl: function() { var me = this, targetEl = me.getTargetEl(), all = me.all, store = me.getStore(), i, removedItems, removedRecs, nodeContainerIsTarget = me.getNodeContainer() === targetEl; // We must ensure that the itemremove event is fired EVERY time an item is removed from the // view. This is so that widgets rendered into a view by a WidgetColumn can be recycled. removedItems = all.slice(); removedRecs = []; for (i = all.startIndex; i <= all.endIndex; i++) { removedRecs.push(store.getByInternalId(all.item(i, true).getAttribute('data-recordId'))); } me.fireItemMutationEvent('itemremove', removedRecs, all.startIndex || 0, removedItems, me); me.clearEmptyEl(); // If nodeContainer is the el, just clear the innerHTML. Otherwise, we need // to manually remove each node we know about. me.all.clear(!nodeContainerIsTarget); targetEl = nodeContainerIsTarget ? targetEl.dom : me.getNodeContainer(); if (targetEl) { targetEl.innerHTML = ''; } }, clearEmptyEl: function() { var emptyEl = this.emptyEl; // emptyEl is likely to be a TextNode if emptyText is not HTML code. // Use native DOM to remove it. if (emptyEl) { Ext.removeNode(emptyEl); } this.emptyEl = null; }, onViewScroll: function(scroller, x, y) { if (!this.destroyed) { this.fireEvent('scroll', this, x, y); } }, onViewScrollEnd: function(scroller, x, y) { if (!this.destroyed) { this.fireEvent('scrollend', this, x, y); } }, /** * Saves the scrollState in a private variable. Must be used in conjunction with restoreScrollState. * @private */ saveScrollState: function() { var me = this, state = me.scrollState; if (me.rendered) { state.left = me.getScrollX(); state.top = me.getScrollY(); } }, /** * Restores the scrollState. * Must be used in conjunction with saveScrollState * @private */ restoreScrollState: function() { var me = this, state = me.scrollState; if (me.rendered) { me.setScrollX(state.left); me.setScrollY(state.top); } }, /** * Function which can be overridden to provide custom formatting for each Record that is used by this * DataView's {@link #tpl template} to render each node. * @param {Object/Object[]} data The raw data object that was used to create the Record. * @param {Number} recordIndex the index number of the Record being prepared for rendering. * @param {Ext.data.Model} record The Record being prepared for rendering. * @return {Array/Object} The formatted data in a format expected by the internal {@link #tpl template}'s overwrite() method. * (either an array if your params are numeric (i.e. {0}) or an object (i.e. {foo: 'bar'})) * @since 2.3.0 */ prepareData: function(data, recordIndex, record) { var associatedData, attr, hasCopied; if (record) { associatedData = record.getAssociatedData(); for (attr in associatedData) { if (associatedData.hasOwnProperty(attr)) { // This would be better done in collectData, however // we only need to copy the data object if we have any associations, // so we optimize it by only copying if we must. // We do this so we don't mutate the underlying record.data if (!hasCopied) { data = Ext.Object.chain(data); hasCopied = true; } data[attr] = associatedData[attr]; } } } return data; }, /** * Function which can be overridden which returns the data object passed to this * DataView's {@link #cfg-tpl template} to render the whole DataView. * * This is usually an Array of data objects, each element of which is processed by an * {@link Ext.XTemplate XTemplate} which uses `'<tpl for=".">'` to iterate over its supplied * data object as an Array. However, <i>named</i> properties may be placed into the data object to * provide non-repeating data such as headings, totals etc. * * @param {Ext.data.Model[]} records An Array of {@link Ext.data.Model}s to be rendered into the DataView. * @param {Number} startIndex the index number of the Record being prepared for rendering. * @return {Object[]} An Array of data objects to be processed by a repeating XTemplate. May also * contain <i>named</i> properties. * @since 2.3.0 */ collectData: function(records, startIndex){ var data = [], i = 0, len = records.length, record; for (; i < len; i++) { record = records[i]; data[i] = this.prepareData(record.data, startIndex + i, record); } return data; }, cleanupData: Ext.emptyFn, bufferRender: function(records, index) { var me = this, div = me.renderBuffer, result = document.createDocumentFragment(), nodes, len, i; me.tpl.overwrite(div, me.collectData(records, index)); nodes = div.query(me.getItemSelector()); for (i = 0, len = nodes.length; i < len; i++) { result.appendChild(nodes[i]); } return { fragment: result, children: nodes }; }, // Element which contains rows nodeContainerSelector: null, /** * For use by the {@link Ext.view.DragZone} plugin on platforms which use the * [Pointer Events standard](https://www.w3.org/TR/pointerevents/). * * If using touch scrolling, the `pointerdown` event is reserved for starting the scroll * gesture. To enable dragging of items using the ExtJS drag/drop system, items * must be set draggable. This means that `pointerdown` on view items initiate an ExtJS drag * and *not* a scroll gesture. * * When items are set draggable: true, pointer events platforms can still scroll using two * finger drag, or by dragging empty parts of the view. * * For normal dataviews, havig the backgrounc-color of items and the view be different will * indicate where to touch to initiate a scroll. * * For grids, if rows need to be dragged, there must be some blank space after rows * to touch to initiate the scroll gesture. * * @param {type} draggable * @private */ setItemsDraggable: function(draggable) { var me = this, selector = '#' + me.id + ' ' + me.getItemSelector(), styleSheet = me.viewStyleSheet; if (draggable) { if (!styleSheet) { styleSheet = Ext.view.AbstractView.prototype.viewStyleSheet = Ext.util.CSS.createStyleSheet('', 'AbstractView'); } // Pointer Events platforms implement the touch-action or -ms-touch-action properties // which deicate how an element responds to touches. // Non Pointer Events platforms such as iOS show a selection rectangle on longpress+drag, and that // is disabled by -webkit-user-drag: none; Ext.util.CSS.createRule(styleSheet, selector, 'touch-action: pinch-zoom double-tap-zoom;-ms-touch-action: pinch-zoom double-tap-zoom;-webkit-user-drag: none;'); } else if (styleSheet) { Ext.util.CSS.deleteRule(selector); } }, /** * Returns a CSS selector which selects the element which contains record nodes. */ getNodeContainerSelector: function() { return this.nodeContainerSelector; }, onUpdate: function(store, record, operation, modifiedFieldNames, details) { var me = this, isFiltered = details && details.filtered; // If, due to filtering or buffered rendering, or node collapse, the updated record is not // represented in the rendered structure, this is a no-op. // The correct, new values will be rendered the next time the record becomes visible and is rendered. if (!isFiltered && me.getNode(record)) { // If we are throttling UI updates (See the updateDelay global config), ensure there's a change entry // queued for the record in the global queue. if (me.throttledUpdate) { me.statics().queueRecordChange(me, store, record, operation, modifiedFieldNames); } else { // Cannot use arguments array. // TableView's signature acceses these arguments plus one more of its own. // Event firing passes the addListener options object as rge final parameter // and we must not pass that. me.handleUpdate(store, record, operation, modifiedFieldNames, details); } } }, handleUpdate: function(store, record){ var me = this, index, node, selModel = me.getSelectionModel(); if (me.viewReady && !me.refreshNeeded) { index = me.dataSource.indexOf(record); // If the record has been removed from the data source since the changes were made, do nothing if (index > -1) { // ensure the node actually exists in the DOM if (me.getNode(record)) { node = me.bufferRender([record], index).children[0]; me.all.replaceElement(index, node, true); me.updateIndexes(index, index); // Maintain selection after update selModel.onUpdate(record); me.refreshSizePending = true; if (selModel.isSelected(record)) { me.onItemSelect(record); } if (me.hasListeners.itemupdate) { me.fireEvent('itemupdate', record, index, node, me); } return node; } } } }, /** * @private * Respond to store replace event which is fired by GroupStore group expand/collapse operations. * This saves a layout because a remove and add operation are coalesced in this operation. */ onReplace: function(store, startIndex, oldRecords, newRecords) { var me = this, all = me.all, scroller = me.getScrollable(), yPos = scroller && scroller.getPosition().y, selModel = me.getSelectionModel(), origStart = startIndex, result, item, fragment, children, oldItems, endIndex, restoreFocus; if (me.rendered) { // Insert the new items before the remove block result = me.bufferRender(newRecords, startIndex, true); fragment = result.fragment; children = result.children; item = all.item(startIndex); if (item) { all.item(startIndex).insertSibling(fragment, 'before', true); } else { me.appendNodes(fragment); } all.insert(startIndex, children); if (oldRecords.length) { // If focus was in the view, this will return // a function which will restore that state. // If not, a function which does nothing. restoreFocus = me.saveFocusState(); } startIndex += newRecords.length; endIndex = startIndex + oldRecords.length - 1; // Remove the items which correspond to old records oldItems = all.removeRange(startIndex, endIndex, true); // Restore scroll position if (scroller) { scroller.scrollTo(null, yPos); } // Some subclasses do not need to do this. TableView does not need to do this. if (me.refreshSelmodelOnRefresh !== false) { selModel.refresh(); } // Update the row indices (TableView) doesn't do this. me.updateIndexes(startIndex); me.fireItemMutationEvent('itemremove', oldRecords, origStart, oldItems, me); me.fireItemMutationEvent('itemadd', newRecords, origStart, children, me); // If focus was in this view, this will restore it restoreFocus(); me.refreshSize(); } }, onAdd: function(store, records, index) { var me = this, nodes, selModel = me.getSelectionModel(); if (me.rendered && !me.refreshNeeded) { // If we are adding into an empty view, we must refresh in order that the *full tpl* is applied // which might create boilerplate content *around* the record nodes. if (me.all.getCount() === 0) { me.refresh(); nodes = me.all.slice(); } else { nodes = me.doAdd(records, index); // Some subclasses do not need to do this. TableView does not need to do this. if (me.refreshSelmodelOnRefresh !== false) { selModel.refresh(); } me.updateIndexes(index); // Ensure layout system knows about new content size me.refreshSizePending = true; } me.fireItemMutationEvent('itemadd', records, index, nodes, me); } }, appendNodes: function(nodes) { var all = this.all, count = all.getCount(); if (this.nodeContainerSelector) { this.getNodeContainer().appendChild(nodes); } else { // If we don't have a nodeContainerSelector, we may have our // itemSelector nodes wrapped in some other container, so we // can't just append them to the node container, it may be the wrong element all.item(count - 1).insertSibling(nodes, 'after'); } }, doAdd: function(records, index) { var me = this, result = me.bufferRender(records, index, true), fragment = result.fragment, children = result.children, all = me.all, count = all.getCount(), firstRowIndex = all.startIndex || 0, lastRowIndex = all.endIndex || count - 1; if (count === 0 || index > lastRowIndex) { me.appendNodes(fragment); } else if (index <= firstRowIndex) { all.item(firstRowIndex).insertSibling(fragment, 'before', true); } else { all.item(index).insertSibling(children, 'before', true); } all.insert(index, children); return children; }, onRemove: function(store, records, index) { var me = this, rows = me.all, currIdx, i, record, nodes, node, restoreFocus; if (me.rendered && !me.refreshNeeded && rows.getCount()) { if (me.dataSource.getCount() === 0) { me.refresh(); } else { // If this view contains focus, this will return // a function which will restore that state. restoreFocus = me.saveFocusState(); // Just remove the elements which corresponds to the removed records // The tpl's full HTML will still be in place. nodes = []; for (i = records.length - 1; i >= 0; --i) { record = records[i]; currIdx = index + i; if (nodes) { node = rows.item(currIdx); nodes[i] = node ? node.dom : undefined; } if (rows.item(currIdx)) { me.doRemove(record, currIdx); } } me.fireItemMutationEvent('itemremove', records, index, nodes, me); // If focus was in this view, this will restore it restoreFocus(); me.updateIndexes(index); } // Ensure layout system knows about new content size me.refreshSizePending = true; } }, doRemove: function(record, index) { this.all.removeElement(index, true); }, eventLifecycleMap: { refresh: 'onViewRefresh', itemremove: 'onItemRemove', itemadd: 'onItemAdd' }, fireItemMutationEvent: function(eventName) { var me = this, ownerGrid = me.ownerGrid, vm; Ext.suspendLayouts(); // Inform the ownerGrid. if (ownerGrid) { if (eventName !== 'refresh') { vm = me.lookupViewModel(); } ownerGrid[me.eventLifecycleMap[eventName]].apply(ownerGrid, Ext.Array.slice(arguments, 1)); } me.fireEvent.apply(me, arguments); // The content height MUST be measurable by the caller (the buffered renderer), so data must be flushed to it immediately. if (vm) { vm.notify(); } Ext.resumeLayouts(true); }, /** * @private * Called prior to an operation which mey remove focus from this view by some kind of DOM operation. * * If this view contains focus, this method returns a function which, when called after * the disruptive DOM operation will restore focus to the same record, or, if the record has * been removed to the same item index.. * * @returns {Function} A function that will restore focus if focus was within this view, * or a function which does nothing is focus is not in this view. */ saveFocusState: function() { var me = this, store = me.dataSource || me.store, navModel = me.getNavigationModel(), lastFocusedIndex = navModel.recordIndex, lastFocusedRec = navModel.record, containsFocus = me.el.contains(Ext.Element.getActiveElement()); // If there is a position to restore... if (lastFocusedRec) { // Check if we really have focus. // Some NavigationModels record position with focus outside of the view. // This happens in BoundLists when focus stays in the bound field. // Blur the focused descendant, but do not trigger focusLeave. if (containsFocus) { me.el.dom.focus(); } // The following function will attempt to refocus back to the same record if it is still there, // or the same item index. return function() { // If we still have data, attempt to refocus at the same record, or the same item index.. if (store.getCount()) { // Adjust expectations of where we are able to refocus according to what kind of destruction // might have been wrought on this view's DOM during focus save. lastFocusedIndex = Math.min(lastFocusedIndex, me.all.getCount() - 1); navModel.setPosition(store.contains(lastFocusedRec) ? lastFocusedRec : lastFocusedIndex, null, null, true, !containsFocus); } }; } return Ext.emptyFn; }, /** * Refreshes an individual node's data from the store. * @param {Ext.data.Model/Number} record The record or index of the record to update. * @since 2.3.0 */ refreshNode: function(record) { if (Ext.isNumber(record)) { record = this.store.getAt(record); } this.onUpdate(this.dataSource, record); }, updateIndexes: function(startIndex, endIndex) { var me = this, nodes = me.all.elements, records = me.getViewRange(), selModel = me.getSelectionModel(), myId = me.id, node, record, i; startIndex = startIndex || 0; endIndex = endIndex || ((endIndex === 0) ? 0 : (nodes.length - 1)); for (i = startIndex; i <= endIndex; i++) { node = nodes[i]; record = records[i]; node.setAttribute('data-recordIndex', i); node.setAttribute('data-recordId', record.internalId); node.setAttribute('data-boundView', myId); if (selModel.getLastSelected()) { me[selModel.isSelected(record) ? 'onItemSelect' : 'onItemDeselect'](record); } } }, /** * Changes the data store bound to this view and refreshes it. * @param {Ext.data.Store} store The store to bind to this view * @param {Object} initial * @since 3.4.0 */ bindStore: function (store, initial) { var me = this, selModel = me.getSelectionModel(), navModel = me.getNavigationModel(); // Can be already destroyed if we're called from doDestroy() if (selModel && !selModel.destroyed) { selModel.bindStore(store, initial); selModel.bindComponent(store ? me : null); } me.mixins.storeholder.bindStore.apply(me, arguments); // Navigation model must bind to new store if (navModel && !navModel.destroyed) { navModel.setStore(store); } // If we have already achieved our first layout, refresh immediately. // If we bind to the Store before the first layout, then beforeLayout will // call doFirstRefresh if (store && me.componentLayoutCounter && !me.blockRefresh) { // If not the initial bind, we enforce noDefer. me.doFirstRefresh(store, !initial); } }, /** * @private * Perform the first refresh of the View from a newly bound store. * * This is called when this View has been sized for the first time. */ doFirstRefresh: function(store, noDefer) { var me = this; // If we are configured to defer, and *NOT* called from the defer call below if (me.deferInitialRefresh && !noDefer) { Ext.defer(me.doFirstRefresh, 1, me, [store, true]); } else { // 4.1.0: If we have a store, and the Store is *NOT* already loading (a refresh is on the way), then // on first layout, refresh regardless of record count. // Template may contain boilerplate HTML outside of record iteration loop. // Also, emptyText is appended by the refresh method. if (store && !me.deferRefreshForLoad(store)) { me.refresh(); } } }, onUnbindStore: function(store) { this.setMaskBind(null); if (this.dataSource === store) { this.dataSource = null; } }, onBindStore: function(store, oldStore) { var me = this; // A BufferedStore has to know to reload the most recent visible zone if its View is preserveScrollOnReload if (me.store.isBufferedStore) { me.store.preserveScrollOnReload = me.preserveScrollOnReload; } if (oldStore && oldStore.isBufferedStore) { delete oldStore.preserveScrollOnReload; } me.setMaskBind(store); // When unbinding the data store, the dataSource will be nulled out if it's the same as the data store. // Restore it here. if (!me.dataSource) { me.dataSource = store; } }, setMaskBind: function(store) { var mask = this.loadMask; if (this.rendered && mask && store && !mask.bindStore) { mask = this.createMask(); } if (mask && mask.bindStore) { mask.bindStore(store); } }, getStoreListeners: function() { var me = this; return { refresh: me.onDataRefresh, replace: me.onReplace, add: me.onAdd, remove: me.onRemove, update: me.onUpdate, clear: me.onDataRefresh, beginupdate: me.onBeginUpdate, endupdate: me.onEndUpdate }; }, onBeginUpdate: function() { ++this.updateSuspendCounter; Ext.suspendLayouts(); }, onEndUpdate: function() { var me = this; if (me.updateSuspendCounter) { --me.updateSuspendCounter; } Ext.resumeLayouts(true); if (me.refreshSizePending) { me.refreshSize(true); me.refreshSizePending = false; } }, /** * @private * Calls this.refresh if this.blockRefresh is not true * @since 3.4.0 */ onDataRefresh: function(store) { var me = this, preserveScrollOnRefresh = me.preserveScrollOnRefresh; // If this refresh event is fire from a store load, then use the // preserveScrollOnReload setting to decide whether to preserve scroll position if (store.loadCount > (me.lastRefreshLoadCount || 0)) { me.preserveScrollOnRefresh = me.preserveScrollOnReload; } me.refreshView(); me.preserveScrollOnRefresh = preserveScrollOnRefresh; me.lastRefreshLoadCount = store.loadCount; }, refreshView: function(startIndex) { var me = this, // If we have an ancestor in a non-boxready state (collapsed or about to collapse, or hidden), then block the // refresh because the next layout will trigger the refresh blocked = me.blockRefresh || !me.rendered || me.up('[collapsed],[isCollapsingOrExpanding=1],[hidden]'), bufferedRenderer = me.bufferedRenderer; // If we are blocked in any way due to either a setting, or hidden or collapsed, or animating ancestor, then // the next refresh attempt at the upcoming layout must not defer. if (blocked) { me.refreshNeeded = true; } else { if (bufferedRenderer) { bufferedRenderer.refreshView(startIndex); } else { me.refresh(); } } }, /** * Returns the template node the passed child belongs to, or null if it doesn't belong to one. * @param {HTMLElement} node * @return {HTMLElement} The template node */ findItemByChild: function(node){ return Ext.fly(node).findParent(this.getItemSelector(), this.getTargetEl()); }, /** * Returns the template node by the Ext.event.Event or null if it is not found. * @param {Ext.event.Event} e */ findTargetByEvent: function(e) { return e.getTarget(this.getItemSelector(), this.getTargetEl()); }, /** * Gets the currently selected nodes. * @return {HTMLElement[]} An array of HTMLElements * @since 2.3.0 */ getSelectedNodes: function(){ var nodes = [], records = this.getSelectionModel().getSelection(), ln = records.length, i = 0; for (; i < ln; i++) { nodes.push(this.getNode(records[i])); } return nodes; }, /** * Gets an array of the records from an array of nodes * @param {HTMLElement[]} nodes The nodes to evaluate * @return {Ext.data.Model[]} records The {@link Ext.data.Model} objects * @since 2.3.0 */ getRecords: function(nodes) { var me = this, records = [], i; for (i=0; i < nodes.length; i++) { records.push(me.getRecord(nodes[i])); } return records; }, /** * Gets a record from a node * @param {Ext.dom.Element/HTMLElement} node The node to evaluate * * @return {Ext.data.Model} record The {@link Ext.data.Model} object * @since 2.3.0 */ getRecord: function(node) { var dom = Ext.getDom(node), id = dom.getAttribute('data-recordId'); return this.dataSource.getByInternalId(id); }, /** * Returns true if the passed node is selected, else false. * @param {HTMLElement/Number/Ext.data.Model} node The node, node index or record to check * @return {Boolean} True if selected, else false * @since 2.3.0 */ isSelected: function(node) { var r = this.getRecord(node); return this.getSelectionModel().isSelected(r); }, /** * Selects a record instance by record instance or index. * @param {Ext.data.Model[]/Number} records An array of records or an index * @param {Boolean} keepExisting * @param {Boolean} suppressEvent Set to false to not fire a select event * @deprecated 4.0 Use {@link Ext.selection.Model#select} instead. * @since 2.3.0 */ select: function(records, keepExisting, suppressEvent) { this.getSelectionModel().select(records, keepExisting, suppressEvent); }, /** * Deselects a record instance by record instance or index. * @param {Ext.data.Model[]/Number} records An array of records or an index * @param {Boolean} suppressEvent Set to false to not fire a deselect event * @since 2.3.0 */ deselect: function(records, suppressEvent) { this.getSelectionModel().deselect(records, suppressEvent); }, /** * Gets a template node. * @param {HTMLElement/String/Number/Ext.data.Model} nodeInfo An HTMLElement template node, index of a template node, * the id of a template node or the record associated with the node. * @return {HTMLElement} The node or null if it wasn't found * @since 2.3.0 */ getNode: function(nodeInfo) { var me = this, out; if (me.rendered && (nodeInfo || nodeInfo === 0)) { if (Ext.isString(nodeInfo)) { // Id out = document.getElementById(nodeInfo); } else if (nodeInfo.isModel) { // Record out = me.getNodeByRecord(nodeInfo); } else if (Ext.isNumber(nodeInfo)) { // Index out = me.all.elements[nodeInfo]; } else { if (nodeInfo.target && nodeInfo.target.nodeType) { // An event. Check that target is a node: <a target="_blank"> must pass unchanged nodeInfo = nodeInfo.target; } out = Ext.fly(nodeInfo).findParent(me.itemSelector, me.getTargetEl()); // already an HTMLElement } } return out || null; }, /** * @private */ getNodeByRecord: function(record) { var index = this.store.indexOf(record); return this.all.elements[index] || null; }, /** * Gets a range nodes. * @param {Number} start (optional) The index of the first node in the range * @param {Number} end (optional) The index of the last node in the range * @return {HTMLElement[]} An array of nodes * @since 2.3.0 */ getNodes: function(start, end) { var all = this.all; if (end !== undefined) { end++; } return all.slice(start, end); }, /** * Finds the index of the passed node. * @param {HTMLElement/String/Number/Ext.data.Model} node An HTMLElement template node, * index of a template node, the id of a template node or a record associated with a node. * @return {Number} The index of the node or -1 * @since 2.3.0 */ indexOf: function(node) { node = this.getNode(node); if (!node && node !== 0) { return -1; } if (node.getAttribute('data-recordIndex')) { return Number(node.getAttribute('data-recordIndex')); } return this.all.indexOf(node); }, doDestroy: function() { var me = this, count = me.updateSuspendCounter, tabGuardEl = me.tabGuardEl; if (me.viewScrollListeners) { me.viewScrollListeners.destroy(); } // Can be already destroyed in Table view if (me.all && !me.all.destroyed) { me.all.clear(); } if (tabGuardEl) { if (tabGuardEl.parentNode) { tabGuardEl.parentNode.removeChild(tabGuardEl); } } me.emptyEl = null; me.setItemsDraggable(false); me.bindStore(null); if (me.selModelRelayer) { me.selModelRelayer.destroy(); } Ext.destroy(me.navigationModel, me.selectionModel, me.loadMask); // We have been destroyed during a begin/end update, which means we're // suspending layouts, must forcibly do it here. while (count--) { Ext.resumeLayouts(true); } me.callParent(); }, // invoked by the selection model to maintain visual UI cues onItemSelect: function(record) { var node = this.getNode(record); if (node) { Ext.fly(node).addCls(this.selectedItemCls); node.setAttribute('aria-selected', 'true'); } return node; }, // invoked by the selection model to maintain visual UI cues onItemDeselect: function(record) { var node = this.getNode(record); if (node) { Ext.fly(node).removeCls(this.selectedItemCls); node.setAttribute('aria-selected', 'false'); } return node; }, getItemSelector: function() { return this.itemSelector; }, /** * Adds a CSS Class to a specific item. * @param {HTMLElement/String/Number/Ext.data.Model} itemInfo An HTMLElement, index or instance of a model * representing this item * @param {String} cls */ addItemCls: function(itemInfo, cls) { var item = this.getNode(itemInfo); if (item) { Ext.fly(item).addCls(cls); } }, /** * Removes a CSS Class from a specific item. * @param {HTMLElement/String/Number/Ext.data.Model} itemInfo An HTMLElement, index or instance of a model * representing this item * @param {String} cls */ removeItemCls: function(itemInfo, cls) { var item = this.getNode(itemInfo); if (item) { Ext.fly(item).removeCls(cls); } }, setStore: function (newStore) { // Here we want to override the config system setter because setting the store is a special case // that the config system wasn't able to handle. // // For instance, because `bindStore` is the only API for both binding and unbinding a store, we // couldn't unbind the old store using the config system because it would simply unbind the new // store that the setter had just poked onto the instance: // // setStore -> intance.store = newStore // updateStore -> view.unbind(null) (unbinds the newStore) // var me = this; if (me.store !== newStore) { if (me.isConfiguring) { me.store = newStore; } else { me.bindStore(newStore, /*initial*/ false); } } }, privates: { deferRefreshForLoad: function(store) { return store.isLoading(); }, toggleChildrenTabbability: function(enableTabbing) { var focusEl = this.getTargetEl(); if (enableTabbing) { focusEl.restoreTabbableState({ skipSelf: true }); } else { // Do NOT includeSaved // Once an item has had tabbability saved, do not increment its save level focusEl.saveTabbableState({ skipSelf: true, includeSaved: false }); } }, /** * @private * Called by refresh to collect the view item nodes. */ collectNodes: function(targetEl) { var all = this.all, options = { role: this.itemAriaRole }; all.fill(Ext.fly(targetEl).query(this.getItemSelector()), all.startIndex || 0); // Subclasses may set focusable to false (BoundList is not focusable) if (this.focusable) { options.tabindex = '-1'; } all.set(options); }, createMask: function(mask) { var me = this, maskStore = me.getStore(), cfg; if (maskStore && !maskStore.isEmptyStore && !maskStore.loadsSynchronously()) { cfg = { target: me, msg: me.loadingText, useMsg: me.loadingUseMsg, // The store gets bound in initComponent, so while // rendering let's push on the store store: maskStore }; // Do not overwrite default msgCls if we do not have a loadingCls if (me.loadingCls) { cfg.msgCls = me.loadingCls; } // either a config object if (Ext.isObject(mask)) { cfg = Ext.apply(cfg, mask); } // Attach the LoadMask to a *Component* so that it can be sensitive to resizing during long loads. // If this DataView is floating, then mask this DataView. // Otherwise, mask its owning Container (or this, if there *is* no owning Container). // LoadMask captures the element upon render. me.loadMask = new Ext.LoadMask(cfg); me.loadMask.on({ scope: me, beforeshow: me.onMaskBeforeShow, hide: me.onMaskHide }); } return me.loadMask; }, /** * @private * This method returns the inner node containing element. This is useful for the bufferedRenderer * or for when the view contains extra elements and we need to point the exact element that will * contain the view nodes. */ getNodeContainer: function() { var target = this.getTargetEl(), selector = this.nodeContainerSelector; return selector ? target.down(selector, true) : target; }, getOverflowEl: function() { // The desired behavior here is just to inherit from the superclass. However, // the superclass method calls this.getTargetEl, which sends us into an infinte // loop because our getTargetEl may call getScrollerEl(), which calls getOverflowEl() return Ext.Component.prototype.getTargetEl.call(this); } }}, function() { // all of this information is available directly // from the SelectionModel itself, the only added methods // to DataView regarding selection will perform some transformation/lookup // between HTMLElement/Nodes to records and vice versa. Ext.deprecate('extjs', '4.0', function() { Ext.view.AbstractView.override({ /** * @cfg {Boolean} [multiSelect=false] * True to allow selection of more than one item at a time, false to allow selection of only a single item * at a time or no selection at all, depending on the value of {@link #singleSelect}. * @deprecated 4.0 Use {@link Ext.selection.Model#cfg-mode} 'MULTI' instead. * @since 2.3.0 */ /** * @cfg {Boolean} [singleSelect] * Allows selection of exactly one item at a time. As this is the default selection mode anyway, this config * is completely ignored. * @removed 4.0 Use {@link Ext.selection.Model#cfg-mode} 'SINGLE' instead. * @since 2.3.0 */ /** * @cfg {Boolean} [simpleSelect=false] * True to enable multiselection by clicking on multiple items without requiring the user to hold Shift or Ctrl, * false to force the user to hold Ctrl or Shift to select more than on item. * @deprecated 4.0 Use {@link Ext.selection.Model#cfg-mode} 'SIMPLE' instead. * @since 2.3.0 */ /** * Gets the number of selected nodes. * @return {Number} The node count * @deprecated 4.0 Use {@link Ext.selection.Model#getCount} instead. * @since 2.3.0 */ getSelectionCount: function(){ if (Ext.global.console) { Ext.global.console.warn("DataView: getSelectionCount will be removed, please interact with the Ext.selection.DataViewModel"); } return this.selModel.getSelection().length; }, /** * Gets an array of the selected records * @return {Ext.data.Model[]} An array of {@link Ext.data.Model} objects * @deprecated 4.0 Use {@link Ext.selection.Model#getSelection} instead. * @since 2.3.0 */ getSelectedRecords: function(){ if (Ext.global.console) { Ext.global.console.warn("DataView: getSelectedRecords will be removed, please interact with the Ext.selection.DataViewModel"); } return this.selModel.getSelection(); }, // documented above // @ignore select: function(records, keepExisting, supressEvents) { if (Ext.global.console) { Ext.global.console.warn("DataView: select will be removed, please access select through a DataView's SelectionModel, ie: view.getSelectionModel().select()"); } var sm = this.getSelectionModel(); return sm.select.apply(sm, arguments); }, /** * Deselects all selected records. * @deprecated 4.0 Use {@link Ext.selection.Model#deselectAll} instead. * @since 2.3.0 */ clearSelections: function() { if (Ext.global.console) { Ext.global.console.warn("DataView: clearSelections will be removed, please access deselectAll through DataView's SelectionModel, ie: view.getSelectionModel().deselectAll()"); } var sm = this.getSelectionModel(); return sm.deselectAll(); } }); });});